C31H32N6O2 — CID 144566245
(Z)-3-cyclopropyl-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile;6,7-dimethyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 144566245) has the molecular formula C31H32N6O2 and a molecular weight of 520.64 g/mol. Its IUPAC name is (Z)-3-cyclopropyl-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile;6,7-dimethyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (Z)-3-cyclopropyl-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile;6,7-dimethyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 144566245 |
| Molecular Formula | C31H32N6O2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (Z)-3-cyclopropyl-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile;6,7-dimethyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1c(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc2n1C.N#C/C(=C/C1CC1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C20H18N4O.C11H14N2O/c1-13-17(18-19(21)22-12-23-20(18)24(13)2)14-8-10-16(11-9-14)25-15-6-4-3-5-7-15;12-8-10(7-9-3-4-9)11(14)13-5-1-2-6-13/h3-12H,1-2H3,(H2,21,22,23);7,9H,1-6H2/b;10-7- |
| InChIKey | XOHDGLIZZTVPSP-QYCSVTBISA-N |
| XLogP | 5.79 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|