C32H33N7O2 — CID 123190774
2-[2-[[4-amino-6-methyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-4-(cyclopropylamino)but-2-enenitrile (PubChem CID 123190774) has the molecular formula C32H33N7O2 and a molecular weight of 547.66 g/mol. Its IUPAC name is 2-[2-[[4-amino-6-methyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-4-(cyclopropylamino)but-2-enenitrile.
| Compound Name | 2-[2-[[4-amino-6-methyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-4-(cyclopropylamino)but-2-enenitrile |
|---|---|
| PubChem CID | 123190774 |
| Molecular Formula | C32H33N7O2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 2-[2-[[4-amino-6-methyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-4-(cyclopropylamino)but-2-enenitrile |
| SMILES | Cc1c(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc2n1CC1CCCN1C(=O)C(C#N)=CCNC1CC1 |
| InChI | InChI=1S/C32H33N7O2/c1-21-28(22-9-13-27(14-10-22)41-26-7-3-2-4-8-26)29-30(34)36-20-37-31(29)39(21)19-25-6-5-17-38(25)32(40)23(18-33)15-16-35-24-11-12-24/h2-4,7-10,13-15,20,24-25,35H,5-6,11-12,16-17,19H2,1H3,(H2,34,36,37) |
| InChIKey | NMNYJSXYMQTOAL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|