C31H34N8O3 — CID 122511602
(Z)-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-methyl-4-(propan-2-ylamino)pent-2-enenitrile (PubChem CID 122511602) has the molecular formula C31H34N8O3 and a molecular weight of 566.67 g/mol. Its IUPAC name is (Z)-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-methyl-4-(propan-2-ylamino)pent-2-enenitrile.
| Compound Name | (Z)-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-methyl-4-(propan-2-ylamino)pent-2-enenitrile |
|---|---|
| PubChem CID | 122511602 |
| Molecular Formula | C31H34N8O3 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | (Z)-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-methyl-4-(propan-2-ylamino)pent-2-enenitrile |
| SMILES | CC(C)NC(C)(C)/C=C(/C#N)C(=O)N1CC[C@H]1Cn1c(=O)n(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C31H34N8O3/c1-20(2)36-31(3,4)16-21(17-32)29(40)37-15-14-23(37)18-38-28-26(27(33)34-19-35-28)39(30(38)41)22-10-12-25(13-11-22)42-24-8-6-5-7-9-24/h5-13,16,19-20,23,36H,14-15,18H2,1-4H3,(H2,33,34,35)/b21-16-/t23-/m0/s1 |
| InChIKey | DSUMOFMQYRJUET-ODFZLOHPSA-N |
| XLogP | 3.78 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|