C31H34N8O4 — CID 122511537
(E)-N-[(2S)-1-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]propan-2-yl]-2-cyano-4-methyl-4-morpholin-4-ylpent-2-enamide (PubChem CID 122511537) has the molecular formula C31H34N8O4 and a molecular weight of 582.67 g/mol. Its IUPAC name is (E)-N-[(2S)-1-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]propan-2-yl]-2-cyano-4-methyl-4-morpholin-4-ylpent-2-enamide.
| Compound Name | (E)-N-[(2S)-1-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]propan-2-yl]-2-cyano-4-methyl-4-morpholin-4-ylpent-2-enamide |
|---|---|
| PubChem CID | 122511537 |
| Molecular Formula | C31H34N8O4 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | (E)-N-[(2S)-1-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]propan-2-yl]-2-cyano-4-methyl-4-morpholin-4-ylpent-2-enamide |
| SMILES | C[C@@H](Cn1c(=O)n(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21)NC(=O)/C(C#N)=C/C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C31H34N8O4/c1-21(36-29(40)22(18-32)17-31(2,3)37-13-15-42-16-14-37)19-38-28-26(27(33)34-20-35-28)39(30(38)41)23-9-11-25(12-10-23)43-24-7-5-4-6-8-24/h4-12,17,20-21H,13-16,19H2,1-3H3,(H,36,40)(H2,33,34,35)/b22-17+/t21-/m0/s1 |
| InChIKey | BWYFSUGZXLMUDU-LXDMNWQESA-N |
| XLogP | 3.02 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|