C31H35N7O4 — CID 122511892
(E)-N-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]-2,2-dimethylpropyl]-2-cyano-4-ethoxy-4-methylpent-2-enamide (PubChem CID 122511892) has the molecular formula C31H35N7O4 and a molecular weight of 569.67 g/mol. Its IUPAC name is (E)-N-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]-2,2-dimethylpropyl]-2-cyano-4-ethoxy-4-methylpent-2-enamide.
| Compound Name | (E)-N-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]-2,2-dimethylpropyl]-2-cyano-4-ethoxy-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 122511892 |
| Molecular Formula | C31H35N7O4 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | (E)-N-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]-2,2-dimethylpropyl]-2-cyano-4-ethoxy-4-methylpent-2-enamide |
| SMILES | CCOC(C)(C)/C=C(\C#N)C(=O)NCC(C)(C)Cn1c(=O)n(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C31H35N7O4/c1-6-41-31(4,5)16-21(17-32)28(39)34-18-30(2,3)19-37-27-25(26(33)35-20-36-27)38(29(37)40)22-12-14-24(15-13-22)42-23-10-8-7-9-11-23/h7-16,20H,6,18-19H2,1-5H3,(H,34,39)(H2,33,35,36)/b21-16+ |
| InChIKey | CCKQCWYXVBYVDI-LTGZKZEYSA-N |
| XLogP | 4.36 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|