C28H21N7O3 — CID 154061145
3-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]phenyl]-2-cyano-N-methylprop-2-enamide (PubChem CID 154061145) has the molecular formula C28H21N7O3 and a molecular weight of 503.52 g/mol. Its IUPAC name is 3-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]phenyl]-2-cyano-N-methylprop-2-enamide.
| Compound Name | 3-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]phenyl]-2-cyano-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 154061145 |
| Molecular Formula | C28H21N7O3 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 3-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]phenyl]-2-cyano-N-methylprop-2-enamide |
| SMILES | CNC(=O)C(C#N)=Cc1cccc(-n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C28H21N7O3/c1-31-27(36)19(16-29)14-18-6-5-7-21(15-18)35-26-24(25(30)32-17-33-26)34(28(35)37)20-10-12-23(13-11-20)38-22-8-3-2-4-9-22/h2-15,17H,1H3,(H,31,36)(H2,30,32,33) |
| InChIKey | CPOHXQTYKHGVQZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|