C31H31N7O5 — CID 123544432
4-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]anilino]-N-(2-methoxyethyl)-N-methyl-4-oxobut-2-en-1-amine oxide (PubChem CID 123544432) has the molecular formula C31H31N7O5 and a molecular weight of 581.63 g/mol. Its IUPAC name is 4-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]anilino]-N-(2-methoxyethyl)-N-methyl-4-oxobut-2-en-1-amine oxide.
| Compound Name | 4-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]anilino]-N-(2-methoxyethyl)-N-methyl-4-oxobut-2-en-1-amine oxide |
|---|---|
| PubChem CID | 123544432 |
| Molecular Formula | C31H31N7O5 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 4-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]anilino]-N-(2-methoxyethyl)-N-methyl-4-oxobut-2-en-1-amine oxide |
| SMILES | COCC[N+](C)([O-])CC=CC(=O)Nc1cccc(-n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C31H31N7O5/c1-38(41,18-19-42-2)17-7-12-27(39)35-22-8-6-9-24(20-22)37-30-28(29(32)33-21-34-30)36(31(37)40)23-13-15-26(16-14-23)43-25-10-4-3-5-11-25/h3-16,20-21H,17-19H2,1-2H3,(H,35,39)(H2,32,33,34) |
| InChIKey | IVSDNHSRAGPIHQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 149.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|