C35H37N6O4+ — CID 163695075
cyclopropyl-[(E)-4-[3-[6-ethyl-8-imino-2-oxo-1-(4-phenoxyphenyl)-4,7-dihydroimidazo[4,5-b]azepin-3-yl]anilino]-4-oxobut-2-enyl]-hydroxy-methylazanium (PubChem CID 163695075) has the molecular formula C35H37N6O4+ and a molecular weight of 605.72 g/mol. Its IUPAC name is cyclopropyl-[(E)-4-[3-[6-ethyl-8-imino-2-oxo-1-(4-phenoxyphenyl)-4,7-dihydroimidazo[4,5-b]azepin-3-yl]anilino]-4-oxobut-2-enyl]-hydroxy-methylazanium.
| Compound Name | cyclopropyl-[(E)-4-[3-[6-ethyl-8-imino-2-oxo-1-(4-phenoxyphenyl)-4,7-dihydroimidazo[4,5-b]azepin-3-yl]anilino]-4-oxobut-2-enyl]-hydroxy-methylazanium |
|---|---|
| PubChem CID | 163695075 |
| Molecular Formula | C35H37N6O4+ |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | cyclopropyl-[(E)-4-[3-[6-ethyl-8-imino-2-oxo-1-(4-phenoxyphenyl)-4,7-dihydroimidazo[4,5-b]azepin-3-yl]anilino]-4-oxobut-2-enyl]-hydroxy-methylazanium |
| SMILES | [H]/N=C1\CC(CC)=CNc2c1n(-c1ccc(Oc3ccccc3)cc1)c(=O)n2-c1cccc(NC(=O)/C=C/C[N+](C)(O)C2CC2)c1 |
| InChI | InChI=1S/C35H36N6O4/c1-3-24-21-31(36)33-34(37-23-24)40(35(43)39(33)26-14-18-30(19-15-26)45-29-11-5-4-6-12-29)27-10-7-9-25(22-27)38-32(42)13-8-20-41(2,44)28-16-17-28/h4-15,18-19,22-23,28,44H,3,16-17,20-21H2,1-2H3,(H2-,36,37,38,42)/p+1/b13-8+ |
| InChIKey | JWHCXZIWMQRMDV-MDWZMJQESA-O |
| XLogP | 6.39 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|