C29H27N7O3 — CID 78145004
N-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 78145004) has the molecular formula C29H27N7O3 and a molecular weight of 521.58 g/mol. Its IUPAC name is N-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 78145004 |
| Molecular Formula | C29H27N7O3 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | N-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)CC=CC(=O)Nc1cccc(-n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C29H27N7O3/c1-34(2)17-7-12-25(37)33-20-8-6-9-22(18-20)36-28-26(27(30)31-19-32-28)35(29(36)38)21-13-15-24(16-14-21)39-23-10-4-3-5-11-23/h3-16,18-19H,17H2,1-2H3,(H,33,37)(H2,30,31,32) |
| InChIKey | QNYDAMSZEOPJCR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|