C29H31N7O3 — CID 123635135
6-amino-9-[(3R)-1-[4-[cyclopropyl(methyl)amino]but-2-enoyl]pyrrolidin-3-yl]-7-(4-phenoxyphenyl)purin-8-one (PubChem CID 123635135) has the molecular formula C29H31N7O3 and a molecular weight of 525.61 g/mol. Its IUPAC name is 6-amino-9-[(3R)-1-[4-[cyclopropyl(methyl)amino]but-2-enoyl]pyrrolidin-3-yl]-7-(4-phenoxyphenyl)purin-8-one.
| Compound Name | 6-amino-9-[(3R)-1-[4-[cyclopropyl(methyl)amino]but-2-enoyl]pyrrolidin-3-yl]-7-(4-phenoxyphenyl)purin-8-one |
|---|---|
| PubChem CID | 123635135 |
| Molecular Formula | C29H31N7O3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 6-amino-9-[(3R)-1-[4-[cyclopropyl(methyl)amino]but-2-enoyl]pyrrolidin-3-yl]-7-(4-phenoxyphenyl)purin-8-one |
| SMILES | CN(CC=CC(=O)N1CC[C@@H](n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1)C1CC1 |
| InChI | InChI=1S/C29H31N7O3/c1-33(20-9-10-20)16-5-8-25(37)34-17-15-22(18-34)36-28-26(27(30)31-19-32-28)35(29(36)38)21-11-13-24(14-12-21)39-23-6-3-2-4-7-23/h2-8,11-14,19-20,22H,9-10,15-18H2,1H3,(H2,30,31,32)/t22-/m1/s1 |
| InChIKey | QEJXORCVCQEEPU-JOCHJYFZSA-N |
| XLogP | 3.38 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|