C32H32N6O2 — CID 90150475
(E)-1-[(3R)-3-[4-amino-6-ethynyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-4-[cyclopropyl(methyl)amino]but-2-en-1-one (PubChem CID 90150475) has the molecular formula C32H32N6O2 and a molecular weight of 532.65 g/mol. Its IUPAC name is (E)-1-[(3R)-3-[4-amino-6-ethynyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-4-[cyclopropyl(methyl)amino]but-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-[4-amino-6-ethynyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-4-[cyclopropyl(methyl)amino]but-2-en-1-one |
|---|---|
| PubChem CID | 90150475 |
| Molecular Formula | C32H32N6O2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (E)-1-[(3R)-3-[4-amino-6-ethynyl-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-4-[cyclopropyl(methyl)amino]but-2-en-1-one |
| SMILES | C#Cc1c(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc2n1[C@@H]1CCN(C(=O)/C=C/CN(C)C2CC2)C1 |
| InChI | InChI=1S/C32H32N6O2/c1-3-27-29(22-11-15-26(16-12-22)40-25-8-5-4-6-9-25)30-31(33)34-21-35-32(30)38(27)24-17-19-37(20-24)28(39)10-7-18-36(2)23-13-14-23/h1,4-12,15-16,21,23-24H,13-14,17-20H2,2H3,(H2,33,34,35)/b10-7+/t24-/m1/s1 |
| InChIKey | INJYNSHPPDRCCZ-VFUOJUBFSA-N |
| XLogP | 4.88 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|