C29H31N7O3S — CID 89454999
6-amino-7-(4-phenoxyphenyl)-9-[(3R)-1-[(E)-4-thiomorpholin-4-ylbut-2-enoyl]pyrrolidin-3-yl]purin-8-one (PubChem CID 89454999) has the molecular formula C29H31N7O3S and a molecular weight of 557.68 g/mol. Its IUPAC name is 6-amino-7-(4-phenoxyphenyl)-9-[(3R)-1-[(E)-4-thiomorpholin-4-ylbut-2-enoyl]pyrrolidin-3-yl]purin-8-one.
| Compound Name | 6-amino-7-(4-phenoxyphenyl)-9-[(3R)-1-[(E)-4-thiomorpholin-4-ylbut-2-enoyl]pyrrolidin-3-yl]purin-8-one |
|---|---|
| PubChem CID | 89454999 |
| Molecular Formula | C29H31N7O3S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 6-amino-7-(4-phenoxyphenyl)-9-[(3R)-1-[(E)-4-thiomorpholin-4-ylbut-2-enoyl]pyrrolidin-3-yl]purin-8-one |
| SMILES | Nc1ncnc2c1n(-c1ccc(Oc3ccccc3)cc1)c(=O)n2[C@@H]1CCN(C(=O)/C=C/CN2CCSCC2)C1 |
| InChI | InChI=1S/C29H31N7O3S/c30-27-26-28(32-20-31-27)36(22-12-14-34(19-22)25(37)7-4-13-33-15-17-40-18-16-33)29(38)35(26)21-8-10-24(11-9-21)39-23-5-2-1-3-6-23/h1-11,20,22H,12-19H2,(H2,30,31,32)/b7-4+/t22-/m1/s1 |
| InChIKey | QCXVXBZLQREJLL-ZMTJCJBESA-N |
| XLogP | 3.34 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|