C25H21FN6O3 — CID 89455384
6-amino-9-(1-but-2-ynoylpyrrolidin-3-yl)-7-[4-(4-fluorophenoxy)phenyl]purin-8-one (PubChem CID 89455384) has the molecular formula C25H21FN6O3 and a molecular weight of 472.48 g/mol. Its IUPAC name is 6-amino-9-(1-but-2-ynoylpyrrolidin-3-yl)-7-[4-(4-fluorophenoxy)phenyl]purin-8-one.
| Compound Name | 6-amino-9-(1-but-2-ynoylpyrrolidin-3-yl)-7-[4-(4-fluorophenoxy)phenyl]purin-8-one |
|---|---|
| PubChem CID | 89455384 |
| Molecular Formula | C25H21FN6O3 |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 6-amino-9-(1-but-2-ynoylpyrrolidin-3-yl)-7-[4-(4-fluorophenoxy)phenyl]purin-8-one |
| SMILES | CC#CC(=O)N1CCC(n2c(=O)n(-c3ccc(Oc4ccc(F)cc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C25H21FN6O3/c1-2-3-21(33)30-13-12-18(14-30)32-24-22(23(27)28-15-29-24)31(25(32)34)17-6-10-20(11-7-17)35-19-8-4-16(26)5-9-19/h4-11,15,18H,12-14H2,1H3,(H2,27,28,29) |
| InChIKey | PMNRIBRSLKHZKI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|