C28H25N7O3 — CID 122511592
(E)-2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile (PubChem CID 122511592) has the molecular formula C28H25N7O3 and a molecular weight of 507.55 g/mol. Its IUPAC name is (E)-2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile.
| Compound Name | (E)-2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
|---|---|
| PubChem CID | 122511592 |
| Molecular Formula | C28H25N7O3 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | (E)-2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
| SMILES | N#C/C(=C\C1CC1)C(=O)N1CC[C@H](n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C28H25N7O3/c29-15-19(14-18-6-7-18)27(36)33-13-12-21(16-33)35-26-24(25(30)31-17-32-26)34(28(35)37)20-8-10-23(11-9-20)38-22-4-2-1-3-5-22/h1-5,8-11,14,17-18,21H,6-7,12-13,16H2,(H2,30,31,32)/b19-14+/t21-/m0/s1 |
| InChIKey | MXFUWLMNLXUERH-CURYZJDOSA-N |
| XLogP | 3.59 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|