C29H27N7O4 — CID 140641499
2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-3-(3-methyloxetan-3-yl)prop-2-enenitrile (PubChem CID 140641499) has the molecular formula C29H27N7O4 and a molecular weight of 537.58 g/mol. Its IUPAC name is 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-3-(3-methyloxetan-3-yl)prop-2-enenitrile.
| Compound Name | 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-3-(3-methyloxetan-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 140641499 |
| Molecular Formula | C29H27N7O4 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-3-(3-methyloxetan-3-yl)prop-2-enenitrile |
| SMILES | CC1(C=C(C#N)C(=O)N2CC[C@H](n3c(=O)n(-c4ccc(Oc5ccccc5)cc4)c4c(N)ncnc43)C2)COC1 |
| InChI | InChI=1S/C29H27N7O4/c1-29(16-39-17-29)13-19(14-30)27(37)34-12-11-21(15-34)36-26-24(25(31)32-18-33-26)35(28(36)38)20-7-9-23(10-8-20)40-22-5-3-2-4-6-22/h2-10,13,18,21H,11-12,15-17H2,1H3,(H2,31,32,33)/t21-/m0/s1 |
| InChIKey | QYOGLMHCRPNJLJ-NRFANRHFSA-N |
| XLogP | 3.22 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|