C30H29N7O4 — CID 122511611
(E)-2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-3-(3-methyloxetan-3-yl)prop-2-enenitrile (PubChem CID 122511611) has the molecular formula C30H29N7O4 and a molecular weight of 551.61 g/mol. Its IUPAC name is (E)-2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-3-(3-methyloxetan-3-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-3-(3-methyloxetan-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 122511611 |
| Molecular Formula | C30H29N7O4 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | (E)-2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-3-(3-methyloxetan-3-yl)prop-2-enenitrile |
| SMILES | CC1(/C=C(\C#N)C(=O)N2CCC[C@H](n3c(=O)n(-c4ccc(Oc5ccccc5)cc4)c4c(N)ncnc43)C2)COC1 |
| InChI | InChI=1S/C30H29N7O4/c1-30(17-40-18-30)14-20(15-31)28(38)35-13-5-6-22(16-35)37-27-25(26(32)33-19-34-27)36(29(37)39)21-9-11-24(12-10-21)41-23-7-3-2-4-8-23/h2-4,7-12,14,19,22H,5-6,13,16-18H2,1H3,(H2,32,33,34)/b20-14+/t22-/m0/s1 |
| InChIKey | CNJZLLYPWXSIFH-FGGAIWKESA-N |
| XLogP | 3.61 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|