C32H34N8O3 — CID 122512044
2-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]azetidine-1-carbonyl]-4-methyl-4-piperidin-1-ylpent-2-enenitrile (PubChem CID 122512044) has the molecular formula C32H34N8O3 and a molecular weight of 578.68 g/mol. Its IUPAC name is 2-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]azetidine-1-carbonyl]-4-methyl-4-piperidin-1-ylpent-2-enenitrile.
| Compound Name | 2-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]azetidine-1-carbonyl]-4-methyl-4-piperidin-1-ylpent-2-enenitrile |
|---|---|
| PubChem CID | 122512044 |
| Molecular Formula | C32H34N8O3 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 2-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]azetidine-1-carbonyl]-4-methyl-4-piperidin-1-ylpent-2-enenitrile |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CC(n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1)N1CCCCC1 |
| InChI | InChI=1S/C32H34N8O3/c1-32(2,38-15-7-4-8-16-38)17-22(18-33)30(41)37-19-24(20-37)40-29-27(28(34)35-21-36-29)39(31(40)42)23-11-13-26(14-12-23)43-25-9-5-3-6-10-25/h3,5-6,9-14,17,21,24H,4,7-8,15-16,19-20H2,1-2H3,(H2,34,35,36) |
| InChIKey | IXUSHYOKVBRFIE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|