C30H31N7O4 — CID 122511505
2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-5-hydroxy-4,4-dimethylpent-2-enenitrile (PubChem CID 122511505) has the molecular formula C30H31N7O4 and a molecular weight of 553.62 g/mol. Its IUPAC name is 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-5-hydroxy-4,4-dimethylpent-2-enenitrile.
| Compound Name | 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-5-hydroxy-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511505 |
| Molecular Formula | C30H31N7O4 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-5-hydroxy-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCC[C@H](n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1)CO |
| InChI | InChI=1S/C30H31N7O4/c1-30(2,18-38)15-20(16-31)28(39)35-14-6-7-22(17-35)37-27-25(26(32)33-19-34-27)36(29(37)40)21-10-12-24(13-11-21)41-23-8-4-3-5-9-23/h3-5,8-13,15,19,22,38H,6-7,14,17-18H2,1-2H3,(H2,32,33,34)/t22-/m0/s1 |
| InChIKey | WEQBPFJORUQDCD-QFIPXVFZSA-N |
| XLogP | 3.59 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|