C27H26N8O3 — CID 122511868
4-amino-2-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]azetidine-1-carbonyl]-4-methylpent-2-enenitrile (PubChem CID 122511868) has the molecular formula C27H26N8O3 and a molecular weight of 510.56 g/mol. Its IUPAC name is 4-amino-2-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]azetidine-1-carbonyl]-4-methylpent-2-enenitrile.
| Compound Name | 4-amino-2-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]azetidine-1-carbonyl]-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511868 |
| Molecular Formula | C27H26N8O3 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 4-amino-2-[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]azetidine-1-carbonyl]-4-methylpent-2-enenitrile |
| SMILES | CC(C)(N)C=C(C#N)C(=O)N1CC(n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C27H26N8O3/c1-27(2,30)12-17(13-28)25(36)33-14-19(15-33)35-24-22(23(29)31-16-32-24)34(26(35)37)18-8-10-21(11-9-18)38-20-6-4-3-5-7-20/h3-12,16,19H,14-15,30H2,1-2H3,(H2,29,31,32) |
| InChIKey | MEECOSFPWFYNSL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|