C33H36N8O4 — CID 122511899
(Z)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-methyl-4-[methyl(oxetan-3-yl)amino]pent-2-enenitrile (PubChem CID 122511899) has the molecular formula C33H36N8O4 and a molecular weight of 608.70 g/mol. Its IUPAC name is (Z)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-methyl-4-[methyl(oxetan-3-yl)amino]pent-2-enenitrile.
| Compound Name | (Z)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-methyl-4-[methyl(oxetan-3-yl)amino]pent-2-enenitrile |
|---|---|
| PubChem CID | 122511899 |
| Molecular Formula | C33H36N8O4 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | (Z)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-methyl-4-[methyl(oxetan-3-yl)amino]pent-2-enenitrile |
| SMILES | CN(C1COC1)C(C)(C)/C=C(/C#N)C(=O)N1CCC(n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C33H36N8O4/c1-33(2,38(3)25-19-44-20-25)17-22(18-34)31(42)39-15-13-24(14-16-39)41-30-28(29(35)36-21-37-30)40(32(41)43)23-9-11-27(12-10-23)45-26-7-5-4-6-8-26/h4-12,17,21,24-25H,13-16,19-20H2,1-3H3,(H2,35,36,37)/b22-17- |
| InChIKey | TVOUQPZGQNUPEW-XLNRJJMWSA-N |
| XLogP | 3.68 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|