C29H28N8O3 — CID 140641548
3-(1-aminocyclopropyl)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]prop-2-enenitrile (PubChem CID 140641548) has the molecular formula C29H28N8O3 and a molecular weight of 536.60 g/mol. Its IUPAC name is 3-(1-aminocyclopropyl)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]prop-2-enenitrile.
| Compound Name | 3-(1-aminocyclopropyl)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 140641548 |
| Molecular Formula | C29H28N8O3 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 3-(1-aminocyclopropyl)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]prop-2-enenitrile |
| SMILES | N#CC(=CC1(N)CC1)C(=O)N1CCC(n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C29H28N8O3/c30-17-19(16-29(32)12-13-29)27(38)35-14-10-21(11-15-35)37-26-24(25(31)33-18-34-26)36(28(37)39)20-6-8-23(9-7-20)40-22-4-2-1-3-5-22/h1-9,16,18,21H,10-15,32H2,(H2,31,33,34) |
| InChIKey | DXHIJRIYZDDMFZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|