C34H39N9O3 — CID 122511504
2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-4-(4-ethylpiperazin-1-yl)-4-methylpent-2-enenitrile (PubChem CID 122511504) has the molecular formula C34H39N9O3 and a molecular weight of 621.75 g/mol. Its IUPAC name is 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-4-(4-ethylpiperazin-1-yl)-4-methylpent-2-enenitrile.
| Compound Name | 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-4-(4-ethylpiperazin-1-yl)-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511504 |
| Molecular Formula | C34H39N9O3 |
| Molecular Weight | 621.75 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]pyrrolidine-1-carbonyl]-4-(4-ethylpiperazin-1-yl)-4-methylpent-2-enenitrile |
| SMILES | CCN1CCN(C(C)(C)C=C(C#N)C(=O)N2CC[C@H](n3c(=O)n(-c4ccc(Oc5ccccc5)cc4)c4c(N)ncnc43)C2)CC1 |
| InChI | InChI=1S/C34H39N9O3/c1-4-39-16-18-41(19-17-39)34(2,3)20-24(21-35)32(44)40-15-14-26(22-40)43-31-29(30(36)37-23-38-31)42(33(43)45)25-10-12-28(13-11-25)46-27-8-6-5-7-9-27/h5-13,20,23,26H,4,14-19,22H2,1-3H3,(H2,36,37,38)/t26-/m0/s1 |
| InChIKey | BAXMMHXVPHDKMF-SANMLTNESA-N |
| XLogP | 3.60 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|