C36H43N9O3 — CID 140641571
N-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]cyclohexyl]-2-cyano-4-(4-ethylpiperazin-1-yl)-4-methylpent-2-enamide (PubChem CID 140641571) has the molecular formula C36H43N9O3 and a molecular weight of 649.80 g/mol. Its IUPAC name is N-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]cyclohexyl]-2-cyano-4-(4-ethylpiperazin-1-yl)-4-methylpent-2-enamide.
| Compound Name | N-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]cyclohexyl]-2-cyano-4-(4-ethylpiperazin-1-yl)-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 140641571 |
| Molecular Formula | C36H43N9O3 |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | N-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]cyclohexyl]-2-cyano-4-(4-ethylpiperazin-1-yl)-4-methylpent-2-enamide |
| SMILES | CCN1CCN(C(C)(C)C=C(C#N)C(=O)NC2CCC(n3c(=O)n(-c4ccc(Oc5ccccc5)cc4)c4c(N)ncnc43)CC2)CC1 |
| InChI | InChI=1S/C36H43N9O3/c1-4-42-18-20-43(21-19-42)36(2,3)22-25(23-37)34(46)41-26-10-12-28(13-11-26)45-33-31(32(38)39-24-40-33)44(35(45)47)27-14-16-30(17-15-27)48-29-8-6-5-7-9-29/h5-9,14-17,22,24,26,28H,4,10-13,18-21H2,1-3H3,(H,41,46)(H2,38,39,40) |
| InChIKey | ZKQNXMLTMVQUHI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 147.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|