C31H32N8O3 — CID 122511678
N-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]cyclohexyl]-2-cyano-3-[(2S)-pyrrolidin-2-yl]prop-2-enamide (PubChem CID 122511678) has the molecular formula C31H32N8O3 and a molecular weight of 564.65 g/mol. Its IUPAC name is N-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]cyclohexyl]-2-cyano-3-[(2S)-pyrrolidin-2-yl]prop-2-enamide.
| Compound Name | N-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]cyclohexyl]-2-cyano-3-[(2S)-pyrrolidin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122511678 |
| Molecular Formula | C31H32N8O3 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | N-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]cyclohexyl]-2-cyano-3-[(2S)-pyrrolidin-2-yl]prop-2-enamide |
| SMILES | N#CC(=C[C@@H]1CCCN1)C(=O)NC1CCC(n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C31H32N8O3/c32-18-20(17-22-5-4-16-34-22)30(40)37-21-8-10-24(11-9-21)39-29-27(28(33)35-19-36-29)38(31(39)41)23-12-14-26(15-13-23)42-25-6-2-1-3-7-25/h1-3,6-7,12-15,17,19,21-22,24,34H,4-5,8-11,16H2,(H,37,40)(H2,33,35,36)/t21?,22-,24?/m0/s1 |
| InChIKey | AOIRXUQJJMVRJP-MHIUNMELSA-N |
| XLogP | 3.76 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|