C31H33N7O4 — CID 122511966
(Z)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-ethoxy-4-methylpent-2-enenitrile (PubChem CID 122511966) has the molecular formula C31H33N7O4 and a molecular weight of 567.65 g/mol. Its IUPAC name is (Z)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-ethoxy-4-methylpent-2-enenitrile.
| Compound Name | (Z)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-ethoxy-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511966 |
| Molecular Formula | C31H33N7O4 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | (Z)-2-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-ethoxy-4-methylpent-2-enenitrile |
| SMILES | CCOC(C)(C)/C=C(/C#N)C(=O)N1CCC(n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C31H33N7O4/c1-4-41-31(2,3)18-21(19-32)29(39)36-16-14-23(15-17-36)38-28-26(27(33)34-20-35-28)37(30(38)40)22-10-12-25(13-11-22)42-24-8-6-5-7-9-24/h5-13,18,20,23H,4,14-17H2,1-3H3,(H2,33,34,35)/b21-18- |
| InChIKey | FHQSEEDAWBBRCW-UZYVYHOESA-N |
| XLogP | 4.39 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|