C33H37N9O3 — CID 122511800
2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-methyl-4-piperazin-1-ylpent-2-enenitrile (PubChem CID 122511800) has the molecular formula C33H37N9O3 and a molecular weight of 607.72 g/mol. Its IUPAC name is 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-methyl-4-piperazin-1-ylpent-2-enenitrile.
| Compound Name | 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-methyl-4-piperazin-1-ylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511800 |
| Molecular Formula | C33H37N9O3 |
| Molecular Weight | 607.72 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 2-[(3S)-3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidine-1-carbonyl]-4-methyl-4-piperazin-1-ylpent-2-enenitrile |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCC[C@H](n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1)N1CCNCC1 |
| InChI | InChI=1S/C33H37N9O3/c1-33(2,40-17-14-36-15-18-40)19-23(20-34)31(43)39-16-6-7-25(21-39)42-30-28(29(35)37-22-38-30)41(32(42)44)24-10-12-27(13-11-24)45-26-8-4-3-5-9-26/h3-5,8-13,19,22,25,36H,6-7,14-18,21H2,1-2H3,(H2,35,37,38)/t25-/m0/s1 |
| InChIKey | IZGQOSDWYXTGAU-VWLOTQADSA-N |
| XLogP | 3.25 |
| TPSA | 147.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|