C33H36N8O3 — CID 122511470
(Z)-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]pyrrolidine-1-carbonyl]-4-methyl-4-pyrrolidin-1-ylpent-2-enenitrile (PubChem CID 122511470) has the molecular formula C33H36N8O3 and a molecular weight of 592.70 g/mol. Its IUPAC name is (Z)-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]pyrrolidine-1-carbonyl]-4-methyl-4-pyrrolidin-1-ylpent-2-enenitrile.
| Compound Name | (Z)-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]pyrrolidine-1-carbonyl]-4-methyl-4-pyrrolidin-1-ylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511470 |
| Molecular Formula | C33H36N8O3 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | (Z)-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]pyrrolidine-1-carbonyl]-4-methyl-4-pyrrolidin-1-ylpent-2-enenitrile |
| SMILES | CC(C)(/C=C(/C#N)C(=O)N1CCC[C@H]1Cn1c(=O)n(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21)N1CCCC1 |
| InChI | InChI=1S/C33H36N8O3/c1-33(2,38-16-6-7-17-38)19-23(20-34)31(42)39-18-8-9-25(39)21-40-30-28(29(35)36-22-37-30)41(32(40)43)24-12-14-27(15-13-24)44-26-10-4-3-5-11-26/h3-5,10-15,19,22,25H,6-9,16-18,21H2,1-2H3,(H2,35,36,37)/b23-19-/t25-/m0/s1 |
| InChIKey | CHACOOPMDASCPK-VQZNFWSPSA-N |
| XLogP | 4.27 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|