C30H32N8O3 — CID 122511736
2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-(ethylamino)-4-methylpent-2-enenitrile (PubChem CID 122511736) has the molecular formula C30H32N8O3 and a molecular weight of 552.64 g/mol. Its IUPAC name is 2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-(ethylamino)-4-methylpent-2-enenitrile.
| Compound Name | 2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-(ethylamino)-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511736 |
| Molecular Formula | C30H32N8O3 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-(ethylamino)-4-methylpent-2-enenitrile |
| SMILES | CCNC(C)(C)C=C(C#N)C(=O)N1CC[C@H]1Cn1c(=O)n(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C30H32N8O3/c1-4-35-30(2,3)16-20(17-31)28(39)36-15-14-22(36)18-37-27-25(26(32)33-19-34-27)38(29(37)40)21-10-12-24(13-11-21)41-23-8-6-5-7-9-23/h5-13,16,19,22,35H,4,14-15,18H2,1-3H3,(H2,32,33,34)/t22-/m0/s1 |
| InChIKey | VNOAYXYSIUQQBV-QFIPXVFZSA-N |
| XLogP | 3.40 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|