C30H32N8O4 — CID 122511748
(E)-N-[(2S)-1-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]propan-2-yl]-2-cyano-4-methyl-4-(oxetan-3-ylamino)pent-2-enamide (PubChem CID 122511748) has the molecular formula C30H32N8O4 and a molecular weight of 568.64 g/mol. Its IUPAC name is (E)-N-[(2S)-1-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]propan-2-yl]-2-cyano-4-methyl-4-(oxetan-3-ylamino)pent-2-enamide.
| Compound Name | (E)-N-[(2S)-1-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]propan-2-yl]-2-cyano-4-methyl-4-(oxetan-3-ylamino)pent-2-enamide |
|---|---|
| PubChem CID | 122511748 |
| Molecular Formula | C30H32N8O4 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (E)-N-[(2S)-1-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]propan-2-yl]-2-cyano-4-methyl-4-(oxetan-3-ylamino)pent-2-enamide |
| SMILES | C[C@@H](Cn1c(=O)n(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21)NC(=O)/C(C#N)=C/C(C)(C)NC1COC1 |
| InChI | InChI=1S/C30H32N8O4/c1-19(35-28(39)20(14-31)13-30(2,3)36-21-16-41-17-21)15-37-27-25(26(32)33-18-34-27)38(29(37)40)22-9-11-24(12-10-22)42-23-7-5-4-6-8-23/h4-13,18-19,21,36H,15-17H2,1-3H3,(H,35,39)(H2,32,33,34)/b20-13+/t19-/m0/s1 |
| InChIKey | GYQUJVMMOBQHCP-XAJRUKRBSA-N |
| XLogP | 2.68 |
| TPSA | 162.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|