C27H25N7O4 — CID 122511638
(Z)-N-[2-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]ethyl]-2-cyano-3-(3-methyloxetan-3-yl)prop-2-enamide (PubChem CID 122511638) has the molecular formula C27H25N7O4 and a molecular weight of 511.54 g/mol. Its IUPAC name is (Z)-N-[2-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]ethyl]-2-cyano-3-(3-methyloxetan-3-yl)prop-2-enamide.
| Compound Name | (Z)-N-[2-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]ethyl]-2-cyano-3-(3-methyloxetan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 122511638 |
| Molecular Formula | C27H25N7O4 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (Z)-N-[2-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]ethyl]-2-cyano-3-(3-methyloxetan-3-yl)prop-2-enamide |
| SMILES | CC1(/C=C(/C#N)C(=O)NCCn2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)COC1 |
| InChI | InChI=1S/C27H25N7O4/c1-27(15-37-16-27)13-18(14-28)25(35)30-11-12-33-24-22(23(29)31-17-32-24)34(26(33)36)19-7-9-21(10-8-19)38-20-5-3-2-4-6-20/h2-10,13,17H,11-12,15-16H2,1H3,(H,30,35)(H2,29,31,32)/b18-13- |
| InChIKey | KASZZEAWKSQXND-AQTBWJFISA-N |
| XLogP | 2.56 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|