C29H30N8O3 — CID 122511457
(Z)-4-amino-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]pyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile (PubChem CID 122511457) has the molecular formula C29H30N8O3 and a molecular weight of 538.61 g/mol. Its IUPAC name is (Z)-4-amino-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]pyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile.
| Compound Name | (Z)-4-amino-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]pyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511457 |
| Molecular Formula | C29H30N8O3 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (Z)-4-amino-2-[(2S)-2-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]pyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile |
| SMILES | CC(C)(N)/C=C(/C#N)C(=O)N1CCC[C@H]1Cn1c(=O)n(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C29H30N8O3/c1-29(2,32)15-19(16-30)27(38)35-14-6-7-21(35)17-36-26-24(25(31)33-18-34-26)37(28(36)39)20-10-12-23(13-11-20)40-22-8-4-3-5-9-22/h3-5,8-13,15,18,21H,6-7,14,17,32H2,1-2H3,(H2,31,33,34)/b19-15-/t21-/m0/s1 |
| InChIKey | IFZQIQFEDUQCNI-SACXWWFQSA-N |
| XLogP | 3.13 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|