C32H34N8O4 — CID 122511903
2-[3-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-methyl-4-morpholin-4-ylpent-2-enenitrile (PubChem CID 122511903) has the molecular formula C32H34N8O4 and a molecular weight of 594.68 g/mol. Its IUPAC name is 2-[3-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-methyl-4-morpholin-4-ylpent-2-enenitrile.
| Compound Name | 2-[3-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-methyl-4-morpholin-4-ylpent-2-enenitrile |
|---|---|
| PubChem CID | 122511903 |
| Molecular Formula | C32H34N8O4 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 2-[3-[[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]methyl]azetidine-1-carbonyl]-4-methyl-4-morpholin-4-ylpent-2-enenitrile |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CC(Cn2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1)N1CCOCC1 |
| InChI | InChI=1S/C32H34N8O4/c1-32(2,38-12-14-43-15-13-38)16-23(17-33)30(41)37-18-22(19-37)20-39-29-27(28(34)35-21-36-29)40(31(39)42)24-8-10-26(11-9-24)44-25-6-4-3-5-7-25/h3-11,16,21-22H,12-15,18-20H2,1-2H3,(H2,34,35,36) |
| InChIKey | XIYPIAQNBRMULY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|