C22H23N7O2 — CID 130300783
6-amino-9-(1-aminopiperidin-4-yl)-7-(4-phenoxyphenyl)purin-8-one (PubChem CID 130300783) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 6-amino-9-(1-aminopiperidin-4-yl)-7-(4-phenoxyphenyl)purin-8-one.
| Compound Name | 6-amino-9-(1-aminopiperidin-4-yl)-7-(4-phenoxyphenyl)purin-8-one |
|---|---|
| PubChem CID | 130300783 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 6-amino-9-(1-aminopiperidin-4-yl)-7-(4-phenoxyphenyl)purin-8-one |
| SMILES | Nc1ncnc2c1n(-c1ccc(Oc3ccccc3)cc1)c(=O)n2C1CCN(N)CC1 |
| InChI | InChI=1S/C22H23N7O2/c23-20-19-21(26-14-25-20)29(16-10-12-27(24)13-11-16)22(30)28(19)15-6-8-18(9-7-15)31-17-4-2-1-3-5-17/h1-9,14,16H,10-13,24H2,(H2,23,25,26) |
| InChIKey | PJFVCAUUDNZJBG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|