C34H44N6O4 — CID 176904075
ethyl 10-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidin-1-yl]decanoate (PubChem CID 176904075) has the molecular formula C34H44N6O4 and a molecular weight of 600.76 g/mol. Its IUPAC name is ethyl 10-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidin-1-yl]decanoate.
| Compound Name | ethyl 10-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidin-1-yl]decanoate |
|---|---|
| PubChem CID | 176904075 |
| Molecular Formula | C34H44N6O4 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | ethyl 10-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidin-1-yl]decanoate |
| SMILES | CCOC(=O)CCCCCCCCCN1CCC(n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C34H44N6O4/c1-2-43-30(41)15-11-6-4-3-5-7-12-22-38-23-20-27(21-24-38)40-33-31(32(35)36-25-37-33)39(34(40)42)26-16-18-29(19-17-26)44-28-13-9-8-10-14-28/h8-10,13-14,16-19,25,27H,2-7,11-12,15,20-24H2,1H3,(H2,35,36,37) |
| InChIKey | WRNIVOZFNMYGSU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|