C29H38ClN7O2 — CID 170946728
6-amino-9-[1-(7-aminoheptyl)piperidin-4-yl]-7-(4-phenoxyphenyl)purin-8-one;hydrochloride (PubChem CID 170946728) has the molecular formula C29H38ClN7O2 and a molecular weight of 552.12 g/mol. Its IUPAC name is 6-amino-9-[1-(7-aminoheptyl)piperidin-4-yl]-7-(4-phenoxyphenyl)purin-8-one;hydrochloride.
| Compound Name | 6-amino-9-[1-(7-aminoheptyl)piperidin-4-yl]-7-(4-phenoxyphenyl)purin-8-one;hydrochloride |
|---|---|
| PubChem CID | 170946728 |
| Molecular Formula | C29H38ClN7O2 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 6-amino-9-[1-(7-aminoheptyl)piperidin-4-yl]-7-(4-phenoxyphenyl)purin-8-one;hydrochloride |
| SMILES | Cl.NCCCCCCCN1CCC(n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C29H37N7O2.ClH/c30-17-7-2-1-3-8-18-34-19-15-23(16-20-34)36-28-26(27(31)32-21-33-28)35(29(36)37)22-11-13-25(14-12-22)38-24-9-5-4-6-10-24;/h4-6,9-14,21,23H,1-3,7-8,15-20,30H2,(H2,31,32,33);1H |
| InChIKey | RCAHPPUXGBMGSU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|