C41H43N9O7 — CID 176904063
5-[3-[3-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidin-1-yl]propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 176904063) has the molecular formula C41H43N9O7 and a molecular weight of 773.85 g/mol. Its IUPAC name is 5-[3-[3-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidin-1-yl]propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[3-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidin-1-yl]propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 176904063 |
| Molecular Formula | C41H43N9O7 |
| Molecular Weight | 773.85 g/mol |
| Exact Mass | 773.33 |
| IUPAC Name | 5-[3-[3-[4-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]piperidin-1-yl]propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1ncnc2c1n(-c1ccc(Oc3ccccc3)cc1)c(=O)n2C1CCN(CCCOCCCNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C41H43N9O7/c42-36-35-37(45-25-44-36)49(41(55)48(35)27-9-11-30(12-10-27)57-29-6-2-1-3-7-29)28-16-20-47(21-17-28)19-5-23-56-22-4-18-43-26-8-13-31-32(24-26)40(54)50(39(31)53)33-14-15-34(51)46-38(33)52/h1-3,6-13,24-25,28,33,43H,4-5,14-23H2,(H2,42,44,45)(H,46,51,52) |
| InChIKey | BRCBBDYILBBXQD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 196.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|