C26H21F3N6O3 — CID 89455393
6-amino-9-[(3R)-1-but-2-ynoylpyrrolidin-3-yl]-7-[4-[3-(trifluoromethyl)phenoxy]phenyl]purin-8-one (PubChem CID 89455393) has the molecular formula C26H21F3N6O3 and a molecular weight of 522.49 g/mol. Its IUPAC name is 6-amino-9-[(3R)-1-but-2-ynoylpyrrolidin-3-yl]-7-[4-[3-(trifluoromethyl)phenoxy]phenyl]purin-8-one.
| Compound Name | 6-amino-9-[(3R)-1-but-2-ynoylpyrrolidin-3-yl]-7-[4-[3-(trifluoromethyl)phenoxy]phenyl]purin-8-one |
|---|---|
| PubChem CID | 89455393 |
| Molecular Formula | C26H21F3N6O3 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 6-amino-9-[(3R)-1-but-2-ynoylpyrrolidin-3-yl]-7-[4-[3-(trifluoromethyl)phenoxy]phenyl]purin-8-one |
| SMILES | CC#CC(=O)N1CC[C@@H](n2c(=O)n(-c3ccc(Oc4cccc(C(F)(F)F)c4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C26H21F3N6O3/c1-2-4-21(36)33-12-11-18(14-33)35-24-22(23(30)31-15-32-24)34(25(35)37)17-7-9-19(10-8-17)38-20-6-3-5-16(13-20)26(27,28)29/h3,5-10,13,15,18H,11-12,14H2,1H3,(H2,30,31,32)/t18-/m1/s1 |
| InChIKey | CVAYIYPPUSYVEK-GOSISDBHSA-N |
| XLogP | 3.77 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|