C25H20F2N6O3 — CID 89455156
6-amino-9-(1-but-2-ynoylpyrrolidin-3-yl)-7-[4-(3,5-difluorophenoxy)phenyl]purin-8-one (PubChem CID 89455156) has the molecular formula C25H20F2N6O3 and a molecular weight of 490.47 g/mol. Its IUPAC name is 6-amino-9-(1-but-2-ynoylpyrrolidin-3-yl)-7-[4-(3,5-difluorophenoxy)phenyl]purin-8-one.
| Compound Name | 6-amino-9-(1-but-2-ynoylpyrrolidin-3-yl)-7-[4-(3,5-difluorophenoxy)phenyl]purin-8-one |
|---|---|
| PubChem CID | 89455156 |
| Molecular Formula | C25H20F2N6O3 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 6-amino-9-(1-but-2-ynoylpyrrolidin-3-yl)-7-[4-(3,5-difluorophenoxy)phenyl]purin-8-one |
| SMILES | CC#CC(=O)N1CCC(n2c(=O)n(-c3ccc(Oc4cc(F)cc(F)c4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C25H20F2N6O3/c1-2-3-21(34)31-9-8-18(13-31)33-24-22(23(28)29-14-30-24)32(25(33)35)17-4-6-19(7-5-17)36-20-11-15(26)10-16(27)12-20/h4-7,10-12,14,18H,8-9,13H2,1H3,(H2,28,29,30) |
| InChIKey | DIKKOWKGGMVPDK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|