C27H28ClN7O3 — CID 118064034
6-amino-7-[4-(3-chlorophenoxy)phenyl]-9-[(3R)-3-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]purin-8-one (PubChem CID 118064034) has the molecular formula C27H28ClN7O3 and a molecular weight of 534.02 g/mol. Its IUPAC name is 6-amino-7-[4-(3-chlorophenoxy)phenyl]-9-[(3R)-3-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]purin-8-one.
| Compound Name | 6-amino-7-[4-(3-chlorophenoxy)phenyl]-9-[(3R)-3-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]purin-8-one |
|---|---|
| PubChem CID | 118064034 |
| Molecular Formula | C27H28ClN7O3 |
| Molecular Weight | 534.02 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 6-amino-7-[4-(3-chlorophenoxy)phenyl]-9-[(3R)-3-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-3-yl]purin-8-one |
| SMILES | CN(C)C/C=C/C(=O)[C@@]1(n2c(=O)n(-c3ccc(Oc4cccc(Cl)c4)cc3)c3c(N)ncnc32)CCNC1 |
| InChI | InChI=1S/C27H28ClN7O3/c1-33(2)14-4-7-22(36)27(12-13-30-16-27)35-25-23(24(29)31-17-32-25)34(26(35)37)19-8-10-20(11-9-19)38-21-6-3-5-18(28)15-21/h3-11,15,17,30H,12-14,16H2,1-2H3,(H2,29,31,32)/b7-4+/t27-/m1/s1 |
| InChIKey | SFOYAVGKNXKRGK-ROJSOIAYSA-N |
| XLogP | 2.99 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.02 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|