C21H25N7O2 — CID 144769617
(E)-N-[3-(6-amino-8-oxo-7-prop-1-en-2-ylpurin-9-yl)phenyl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 144769617) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is (E)-N-[3-(6-amino-8-oxo-7-prop-1-en-2-ylpurin-9-yl)phenyl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | (E)-N-[3-(6-amino-8-oxo-7-prop-1-en-2-ylpurin-9-yl)phenyl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 144769617 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (E)-N-[3-(6-amino-8-oxo-7-prop-1-en-2-ylpurin-9-yl)phenyl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | C=C(C)n1c(=O)n(-c2cccc(N(C)C(=O)/C=C/CN(C)C)c2)c2ncnc(N)c21 |
| InChI | InChI=1S/C21H25N7O2/c1-14(2)27-18-19(22)23-13-24-20(18)28(21(27)30)16-9-6-8-15(12-16)26(5)17(29)10-7-11-25(3)4/h6-10,12-13H,1,11H2,2-5H3,(H2,22,23,24)/b10-7+ |
| InChIKey | NWMNFZRJKXICDX-JXMROGBWSA-N |
| XLogP | 1.74 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|