C21H24IN7O — CID 71256152
(E)-N-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-[cyclobutyl(methyl)amino]-N-methylbut-2-enamide (PubChem CID 71256152) has the molecular formula C21H24IN7O and a molecular weight of 517.38 g/mol. Its IUPAC name is (E)-N-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-[cyclobutyl(methyl)amino]-N-methylbut-2-enamide.
| Compound Name | (E)-N-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-[cyclobutyl(methyl)amino]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 71256152 |
| Molecular Formula | C21H24IN7O |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | (E)-N-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-[cyclobutyl(methyl)amino]-N-methylbut-2-enamide |
| SMILES | CN(C(=O)/C=C/CN(C)C1CCC1)c1cccc(-n2nc(I)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C21H24IN7O/c1-27(14-6-3-7-14)11-5-10-17(30)28(2)15-8-4-9-16(12-15)29-21-18(19(22)26-29)20(23)24-13-25-21/h4-5,8-10,12-14H,3,6-7,11H2,1-2H3,(H2,23,24,25)/b10-5+ |
| InChIKey | SOAAWGKLNAUPFH-BJMVGYQFSA-N |
| XLogP | 3.01 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|