C17H18IN7O — CID 71263114
(E)-N-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 71263114) has the molecular formula C17H18IN7O and a molecular weight of 463.28 g/mol. Its IUPAC name is (E)-N-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 71263114 |
| Molecular Formula | C17H18IN7O |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (E)-N-[3-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cccc(-n2nc(I)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C17H18IN7O/c1-24(2)8-4-7-13(26)22-11-5-3-6-12(9-11)25-17-14(15(18)23-25)16(19)20-10-21-17/h3-7,9-10H,8H2,1-2H3,(H,22,26)(H2,19,20,21)/b7-4+ |
| InChIKey | XMXVWTJAGDAKCK-QPJJXVBHSA-N |
| XLogP | 2.06 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|