C19H23N7O — CID 123881022
N-[4-(4-amino-3-ethylpyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 123881022) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[4-(4-amino-3-ethylpyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[4-(4-amino-3-ethylpyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 123881022 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-[4-(4-amino-3-ethylpyrazolo[3,4-d]pyrimidin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CCc1nn(-c2ccc(NC(=O)C=CCN(C)C)cc2)c2ncnc(N)c12 |
| InChI | InChI=1S/C19H23N7O/c1-4-15-17-18(20)21-12-22-19(17)26(24-15)14-9-7-13(8-10-14)23-16(27)6-5-11-25(2)3/h5-10,12H,4,11H2,1-3H3,(H,23,27)(H2,20,21,22) |
| InChIKey | YZVQBOCLKGQWJD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|