C13H18N2O — CID 118034064
(E)-4-(dimethylamino)-N-(3-methylphenyl)but-2-enamide (PubChem CID 118034064) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-(3-methylphenyl)but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-(3-methylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 118034064 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (E)-4-(dimethylamino)-N-(3-methylphenyl)but-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C=C/CN(C)C)c1 |
| InChI | InChI=1S/C13H18N2O/c1-11-6-4-7-12(10-11)14-13(16)8-5-9-15(2)3/h4-8,10H,9H2,1-3H3,(H,14,16)/b8-5+ |
| InChIKey | LRKRXUGTYFGSII-VMPITWQZSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|