C15H21N3O — CID 172614120
(E)-4-(dimethylamino)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)but-2-enamide (PubChem CID 172614120) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)but-2-enamide |
|---|---|
| PubChem CID | 172614120 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (E)-4-(dimethylamino)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C15H21N3O/c1-18(2)9-3-4-15(19)17-14-6-5-12-7-8-16-11-13(12)10-14/h3-6,10,16H,7-9,11H2,1-2H3,(H,17,19)/b4-3+ |
| InChIKey | DDKDUKSFTGYOMT-ONEGZZNKSA-N |
| XLogP | 1.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|