C27H32N6O3 — CID 163889522
6-amino-7-(4-cyclopropyloxyphenyl)-9-[(2E,4E,9E)-11-(dimethylamino)-8-oxoundeca-2,4,9-trien-3-yl]purin-8-one (PubChem CID 163889522) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 6-amino-7-(4-cyclopropyloxyphenyl)-9-[(2E,4E,9E)-11-(dimethylamino)-8-oxoundeca-2,4,9-trien-3-yl]purin-8-one.
| Compound Name | 6-amino-7-(4-cyclopropyloxyphenyl)-9-[(2E,4E,9E)-11-(dimethylamino)-8-oxoundeca-2,4,9-trien-3-yl]purin-8-one |
|---|---|
| PubChem CID | 163889522 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 6-amino-7-(4-cyclopropyloxyphenyl)-9-[(2E,4E,9E)-11-(dimethylamino)-8-oxoundeca-2,4,9-trien-3-yl]purin-8-one |
| SMILES | C/C=C(\C=C\CCC(=O)/C=C/CN(C)C)n1c(=O)n(-c2ccc(OC3CC3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C27H32N6O3/c1-4-19(8-5-6-9-21(34)10-7-17-31(2)3)33-26-24(25(28)29-18-30-26)32(27(33)35)20-11-13-22(14-12-20)36-23-15-16-23/h4-5,7-8,10-14,18,23H,6,9,15-17H2,1-3H3,(H2,28,29,30)/b8-5+,10-7+,19-4+ |
| InChIKey | QAJILTMYWWHCLT-ODTBDLAPSA-N |
| XLogP | 3.59 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|