C26H24N6O3 — CID 89455002
6-amino-7-(4-phenoxyphenyl)-9-[(1-prop-2-ynoylpiperidin-4-yl)methyl]purin-8-one (PubChem CID 89455002) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 6-amino-7-(4-phenoxyphenyl)-9-[(1-prop-2-ynoylpiperidin-4-yl)methyl]purin-8-one.
| Compound Name | 6-amino-7-(4-phenoxyphenyl)-9-[(1-prop-2-ynoylpiperidin-4-yl)methyl]purin-8-one |
|---|---|
| PubChem CID | 89455002 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6-amino-7-(4-phenoxyphenyl)-9-[(1-prop-2-ynoylpiperidin-4-yl)methyl]purin-8-one |
| SMILES | C#CC(=O)N1CCC(Cn2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C26H24N6O3/c1-2-22(33)30-14-12-18(13-15-30)16-31-25-23(24(27)28-17-29-25)32(26(31)34)19-8-10-21(11-9-19)35-20-6-4-3-5-7-20/h1,3-11,17-18H,12-16H2,(H2,27,28,29) |
| InChIKey | WUXPFKYFMOZHRI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|