C25H20N6O5 — CID 152642129
[3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]-5-methoxyphenyl]carbamic acid (PubChem CID 152642129) has the molecular formula C25H20N6O5 and a molecular weight of 484.47 g/mol. Its IUPAC name is [3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]-5-methoxyphenyl]carbamic acid.
| Compound Name | [3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]-5-methoxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 152642129 |
| Molecular Formula | C25H20N6O5 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [3-[6-amino-8-oxo-7-(4-phenoxyphenyl)purin-9-yl]-5-methoxyphenyl]carbamic acid |
| SMILES | COc1cc(NC(=O)O)cc(-n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C25H20N6O5/c1-35-20-12-15(29-24(32)33)11-17(13-20)31-23-21(22(26)27-14-28-23)30(25(31)34)16-7-9-19(10-8-16)36-18-5-3-2-4-6-18/h2-14,29H,1H3,(H,32,33)(H2,26,27,28) |
| InChIKey | ZFUIIAVORPMSMO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |