C29H38N6O2 — CID 134354625
6-amino-9-[(4S)-12-aminododecan-4-yl]-7-(4-phenoxyphenyl)purin-8-one (PubChem CID 134354625) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 6-amino-9-[(4S)-12-aminododecan-4-yl]-7-(4-phenoxyphenyl)purin-8-one.
| Compound Name | 6-amino-9-[(4S)-12-aminododecan-4-yl]-7-(4-phenoxyphenyl)purin-8-one |
|---|---|
| PubChem CID | 134354625 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 6-amino-9-[(4S)-12-aminododecan-4-yl]-7-(4-phenoxyphenyl)purin-8-one |
| SMILES | CCC[C@@H](CCCCCCCCN)n1c(=O)n(-c2ccc(Oc3ccccc3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C29H38N6O2/c1-2-12-22(13-8-5-3-4-6-11-20-30)35-28-26(27(31)32-21-33-28)34(29(35)36)23-16-18-25(19-17-23)37-24-14-9-7-10-15-24/h7,9-10,14-19,21-22H,2-6,8,11-13,20,30H2,1H3,(H2,31,32,33)/t22-/m0/s1 |
| InChIKey | RJHMZGUUSBNSIH-QFIPXVFZSA-N |
| XLogP | 5.99 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|