C28H24N4O2 — CID 145296036
N-[3-[3-[4-(4-methylphenyl)phenyl]-2-oxo-5,6-dihydroimidazo[4,5-c]pyridin-1-yl]phenyl]prop-2-enamide (PubChem CID 145296036) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[3-[3-[4-(4-methylphenyl)phenyl]-2-oxo-5,6-dihydroimidazo[4,5-c]pyridin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[3-[4-(4-methylphenyl)phenyl]-2-oxo-5,6-dihydroimidazo[4,5-c]pyridin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 145296036 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-[3-[3-[4-(4-methylphenyl)phenyl]-2-oxo-5,6-dihydroimidazo[4,5-c]pyridin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c3c(n(-c4ccc(-c5ccc(C)cc5)cc4)c2=O)=CNCC=3)c1 |
| InChI | InChI=1S/C28H24N4O2/c1-3-27(33)30-22-5-4-6-24(17-22)32-25-15-16-29-18-26(25)31(28(32)34)23-13-11-21(12-14-23)20-9-7-19(2)8-10-20/h3-15,17-18,29H,1,16H2,2H3,(H,30,33) |
| InChIKey | AKELEGPXIAEBRZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|